C21H21NO3 — CID 10568805
8-methoxy-3-(2-phenylethyl)-2,4-dihydro-1H-chromeno[3,4-c]pyridin-5-one (PubChem CID 10568805) has the molecular formula C21H21NO3 and a molecular weight of 335.40 g/mol. Its IUPAC name is 8-methoxy-3-(2-phenylethyl)-2,4-dihydro-1H-chromeno[3,4-c]pyridin-5-one.
| Compound Name | 8-methoxy-3-(2-phenylethyl)-2,4-dihydro-1H-chromeno[3,4-c]pyridin-5-one |
|---|---|
| PubChem CID | 10568805 |
| Molecular Formula | C21H21NO3 |
| Molecular Weight | 335.40 g/mol |
| Exact Mass | 335.15 |
| IUPAC Name | 8-methoxy-3-(2-phenylethyl)-2,4-dihydro-1H-chromeno[3,4-c]pyridin-5-one |
| SMILES | COc1ccc2c3c(c(=O)oc2c1)CN(CCc1ccccc1)CC3 |
| InChI | InChI=1S/C21H21NO3/c1-24-16-7-8-18-17-10-12-22(11-9-15-5-3-2-4-6-15)14-19(17)21(23)25-20(18)13-16/h2-8,13H,9-12,14H2,1H3 |
| InChIKey | IAWWLCSYFAOUES-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 42.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.40 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|