C14H14O4S — CID 101379985
7-hydroxy-4-(3-oxobutylsulfanylmethyl)chromen-2-one (PubChem CID 101379985) has the molecular formula C14H14O4S and a molecular weight of 278.33 g/mol. Its IUPAC name is 7-hydroxy-4-(3-oxobutylsulfanylmethyl)chromen-2-one.
| Compound Name | 7-hydroxy-4-(3-oxobutylsulfanylmethyl)chromen-2-one |
|---|---|
| PubChem CID | 101379985 |
| Molecular Formula | C14H14O4S |
| Molecular Weight | 278.33 g/mol |
| Exact Mass | 278.06 |
| IUPAC Name | 7-hydroxy-4-(3-oxobutylsulfanylmethyl)chromen-2-one |
| SMILES | CC(=O)CCSCc1cc(=O)oc2cc(O)ccc12 |
| InChI | InChI=1S/C14H14O4S/c1-9(15)4-5-19-8-10-6-14(17)18-13-7-11(16)2-3-12(10)13/h2-3,6-7,16H,4-5,8H2,1H3 |
| InChIKey | VYASAVMLLIGLRD-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 67.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.33 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|