C26H24N2O10S2 — CID 42605597
(7-hydroxy-2-oxochromen-4-yl)methyl (2R)-2-amino-3-[[(2R)-2-amino-3-[(7-hydroxy-2-oxochromen-4-yl)methoxy]-3-oxopropyl]disulfanyl]propanoate (PubChem CID 42605597) has the molecular formula C26H24N2O10S2 and a molecular weight of 588.62 g/mol. Its IUPAC name is (7-hydroxy-2-oxochromen-4-yl)methyl (2R)-2-amino-3-[[(2R)-2-amino-3-[(7-hydroxy-2-oxochromen-4-yl)methoxy]-3-oxopropyl]disulfanyl]propanoate.
| Compound Name | (7-hydroxy-2-oxochromen-4-yl)methyl (2R)-2-amino-3-[[(2R)-2-amino-3-[(7-hydroxy-2-oxochromen-4-yl)methoxy]-3-oxopropyl]disulfanyl]propanoate |
|---|---|
| PubChem CID | 42605597 |
| Molecular Formula | C26H24N2O10S2 |
| Molecular Weight | 588.62 g/mol |
| Exact Mass | 588.09 |
| IUPAC Name | (7-hydroxy-2-oxochromen-4-yl)methyl (2R)-2-amino-3-[[(2R)-2-amino-3-[(7-hydroxy-2-oxochromen-4-yl)methoxy]-3-oxopropyl]disulfanyl]propanoate |
| SMILES | N[C@@H](CSSC[C@H](N)C(=O)OCc1cc(=O)oc2cc(O)ccc12)C(=O)OCc1cc(=O)oc2cc(O)ccc12 |
| InChI | InChI=1S/C26H24N2O10S2/c27-19(25(33)35-9-13-5-23(31)37-21-7-15(29)1-3-17(13)21)11-39-40-12-20(28)26(34)36-10-14-6-24(32)38-22-8-16(30)2-4-18(14)22/h1-8,19-20,29-30H,9-12,27-28H2/t19-,20-/m0/s1 |
| InChIKey | LOHSTNLYLYSPJL-PMACEKPBSA-N |
| XLogP | 2.13 |
| TPSA | 205.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.62 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|