C14H15NO5S — CID 60920978
2-amino-4-[(7-hydroxy-2-oxochromen-4-yl)methylsulfanyl]butanoic acid (PubChem CID 60920978) has the molecular formula C14H15NO5S and a molecular weight of 309.34 g/mol. Its IUPAC name is 2-amino-4-[(7-hydroxy-2-oxochromen-4-yl)methylsulfanyl]butanoic acid.
| Compound Name | 2-amino-4-[(7-hydroxy-2-oxochromen-4-yl)methylsulfanyl]butanoic acid |
|---|---|
| PubChem CID | 60920978 |
| Molecular Formula | C14H15NO5S |
| Molecular Weight | 309.34 g/mol |
| Exact Mass | 309.07 |
| IUPAC Name | 2-amino-4-[(7-hydroxy-2-oxochromen-4-yl)methylsulfanyl]butanoic acid |
| SMILES | NC(CCSCc1cc(=O)oc2cc(O)ccc12)C(=O)O |
| InChI | InChI=1S/C14H15NO5S/c15-11(14(18)19)3-4-21-7-8-5-13(17)20-12-6-9(16)1-2-10(8)12/h1-2,5-6,11,16H,3-4,7,15H2,(H,18,19) |
| InChIKey | VWNIPSDWRODZPM-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 113.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.34 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|