C13H13NO5 — CID 83193373
(2S)-2-[(7-hydroxy-2-oxochromen-4-yl)methylamino]propanoic acid (PubChem CID 83193373) has the molecular formula C13H13NO5 and a molecular weight of 263.25 g/mol. Its IUPAC name is (2S)-2-[(7-hydroxy-2-oxochromen-4-yl)methylamino]propanoic acid.
| Compound Name | (2S)-2-[(7-hydroxy-2-oxochromen-4-yl)methylamino]propanoic acid |
|---|---|
| PubChem CID | 83193373 |
| Molecular Formula | C13H13NO5 |
| Molecular Weight | 263.25 g/mol |
| Exact Mass | 263.08 |
| IUPAC Name | (2S)-2-[(7-hydroxy-2-oxochromen-4-yl)methylamino]propanoic acid |
| SMILES | C[C@H](NCc1cc(=O)oc2cc(O)ccc12)C(=O)O |
| InChI | InChI=1S/C13H13NO5/c1-7(13(17)18)14-6-8-4-12(16)19-11-5-9(15)2-3-10(8)11/h2-5,7,14-15H,6H2,1H3,(H,17,18)/t7-/m0/s1 |
| InChIKey | PJKJEINHWKRFNA-ZETCQYMHSA-N |
| XLogP | 1.06 |
| TPSA | 99.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.25 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|