C14H14N2O6 — CID 59445812
methyl N-[[[2-(7-hydroxy-2-oxochromen-4-yl)acetyl]amino]methyl]carbamate (PubChem CID 59445812) has the molecular formula C14H14N2O6 and a molecular weight of 306.27 g/mol. Its IUPAC name is methyl N-[[[2-(7-hydroxy-2-oxochromen-4-yl)acetyl]amino]methyl]carbamate.
| Compound Name | methyl N-[[[2-(7-hydroxy-2-oxochromen-4-yl)acetyl]amino]methyl]carbamate |
|---|---|
| PubChem CID | 59445812 |
| Molecular Formula | C14H14N2O6 |
| Molecular Weight | 306.27 g/mol |
| Exact Mass | 306.09 |
| IUPAC Name | methyl N-[[[2-(7-hydroxy-2-oxochromen-4-yl)acetyl]amino]methyl]carbamate |
| SMILES | COC(=O)NCNC(=O)Cc1cc(=O)oc2cc(O)ccc12 |
| InChI | InChI=1S/C14H14N2O6/c1-21-14(20)16-7-15-12(18)4-8-5-13(19)22-11-6-9(17)2-3-10(8)11/h2-3,5-6,17H,4,7H2,1H3,(H,15,18)(H,16,20) |
| InChIKey | LUTUJRCTQJAOFA-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 117.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.27 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|