C14H12NO6- — CID 6954108
3-[[2-(7-hydroxy-2-oxochromen-4-yl)acetyl]amino]propanoate (PubChem CID 6954108) has the molecular formula C14H12NO6- and a molecular weight of 290.25 g/mol. Its IUPAC name is 3-[[2-(7-hydroxy-2-oxochromen-4-yl)acetyl]amino]propanoate.
| Compound Name | 3-[[2-(7-hydroxy-2-oxochromen-4-yl)acetyl]amino]propanoate |
|---|---|
| PubChem CID | 6954108 |
| Molecular Formula | C14H12NO6- |
| Molecular Weight | 290.25 g/mol |
| Exact Mass | 290.07 |
| IUPAC Name | 3-[[2-(7-hydroxy-2-oxochromen-4-yl)acetyl]amino]propanoate |
| SMILES | O=C([O-])CCNC(=O)Cc1cc(=O)oc2cc(O)ccc12 |
| InChI | InChI=1S/C14H13NO6/c16-9-1-2-10-8(6-14(20)21-11(10)7-9)5-12(17)15-4-3-13(18)19/h1-2,6-7,16H,3-5H2,(H,15,17)(H,18,19)/p-1 |
| InChIKey | QLSUBFSMMXVCSW-UHFFFAOYSA-M |
| XLogP | -0.70 |
| TPSA | 119.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.25 |
| LogP ≤ 5 | -0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|