C19H20N2O7 — CID 164887624
4-[[2-(7-hydroxy-2-oxochromen-4-yl)acetyl]amino]-N-[(3S)-2-oxooxolan-3-yl]butanamide (PubChem CID 164887624) has the molecular formula C19H20N2O7 and a molecular weight of 388.38 g/mol. Its IUPAC name is 4-[[2-(7-hydroxy-2-oxochromen-4-yl)acetyl]amino]-N-[(3S)-2-oxooxolan-3-yl]butanamide.
| Compound Name | 4-[[2-(7-hydroxy-2-oxochromen-4-yl)acetyl]amino]-N-[(3S)-2-oxooxolan-3-yl]butanamide |
|---|---|
| PubChem CID | 164887624 |
| Molecular Formula | C19H20N2O7 |
| Molecular Weight | 388.38 g/mol |
| Exact Mass | 388.13 |
| IUPAC Name | 4-[[2-(7-hydroxy-2-oxochromen-4-yl)acetyl]amino]-N-[(3S)-2-oxooxolan-3-yl]butanamide |
| SMILES | O=C(Cc1cc(=O)oc2cc(O)ccc12)NCCCC(=O)N[C@H]1CCOC1=O |
| InChI | InChI=1S/C19H20N2O7/c22-12-3-4-13-11(9-18(25)28-15(13)10-12)8-17(24)20-6-1-2-16(23)21-14-5-7-27-19(14)26/h3-4,9-10,14,22H,1-2,5-8H2,(H,20,24)(H,21,23)/t14-/m0/s1 |
| InChIKey | FNJXFLVJVMUHOM-AWEZNQCLSA-N |
| XLogP | 0.37 |
| TPSA | 134.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.38 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|