C33H33NO9 — CID 160944180
2-(3-hydroxy-6-oxoxanthen-9-yl)benzoic acid;8-oxo-N-[(3S)-2-oxooxolan-3-yl]nonanamide (PubChem CID 160944180) has the molecular formula C33H33NO9 and a molecular weight of 587.63 g/mol. Its IUPAC name is 2-(3-hydroxy-6-oxoxanthen-9-yl)benzoic acid;8-oxo-N-[(3S)-2-oxooxolan-3-yl]nonanamide.
| Compound Name | 2-(3-hydroxy-6-oxoxanthen-9-yl)benzoic acid;8-oxo-N-[(3S)-2-oxooxolan-3-yl]nonanamide |
|---|---|
| PubChem CID | 160944180 |
| Molecular Formula | C33H33NO9 |
| Molecular Weight | 587.63 g/mol |
| Exact Mass | 587.22 |
| IUPAC Name | 2-(3-hydroxy-6-oxoxanthen-9-yl)benzoic acid;8-oxo-N-[(3S)-2-oxooxolan-3-yl]nonanamide |
| SMILES | CC(=O)CCCCCCC(=O)N[C@H]1CCOC1=O.O=C(O)c1ccccc1-c1c2ccc(=O)cc-2oc2cc(O)ccc12 |
| InChI | InChI=1S/C20H12O5.C13H21NO4/c21-11-5-7-15-17(9-11)25-18-10-12(22)6-8-16(18)19(15)13-3-1-2-4-14(13)20(23)24;1-10(15)6-4-2-3-5-7-12(16)14-11-8-9-18-13(11)17/h1-10,21H,(H,23,24);11H,2-9H2,1H3,(H,14,16)/t;11-/m.0/s1 |
| InChIKey | SUWXLBJZUXXCTC-WUSPCOQVSA-N |
| XLogP | 5.32 |
| TPSA | 160.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.63 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|