C37H44N3O7+ — CID 161205152
[9-(2-carboxyphenyl)-6-(dimethylamino)xanthen-3-ylidene]-dimethylazanium;N-[(2R,3S)-2-methyl-4-oxooxetan-3-yl]-8-oxononanamide (PubChem CID 161205152) has the molecular formula C37H44N3O7+ and a molecular weight of 642.77 g/mol. Its IUPAC name is [9-(2-carboxyphenyl)-6-(dimethylamino)xanthen-3-ylidene]-dimethylazanium;N-[(2R,3S)-2-methyl-4-oxooxetan-3-yl]-8-oxononanamide.
| Compound Name | [9-(2-carboxyphenyl)-6-(dimethylamino)xanthen-3-ylidene]-dimethylazanium;N-[(2R,3S)-2-methyl-4-oxooxetan-3-yl]-8-oxononanamide |
|---|---|
| PubChem CID | 161205152 |
| Molecular Formula | C37H44N3O7+ |
| Molecular Weight | 642.77 g/mol |
| Exact Mass | 642.32 |
| IUPAC Name | [9-(2-carboxyphenyl)-6-(dimethylamino)xanthen-3-ylidene]-dimethylazanium;N-[(2R,3S)-2-methyl-4-oxooxetan-3-yl]-8-oxononanamide |
| SMILES | CC(=O)CCCCCCC(=O)N[C@@H]1C(=O)O[C@@H]1C.CN(C)c1ccc2c(-c3ccccc3C(=O)O)c3ccc(=[N+](C)C)cc-3oc2c1 |
| InChI | InChI=1S/C24H22N2O3.C13H21NO4/c1-25(2)15-9-11-19-21(13-15)29-22-14-16(26(3)4)10-12-20(22)23(19)17-7-5-6-8-18(17)24(27)28;1-9(15)7-5-3-4-6-8-11(16)14-12-10(2)18-13(12)17/h5-14H,1-4H3;10,12H,3-8H2,1-2H3,(H,14,16)/p+1/t;10-,12+/m.1/s1 |
| InChIKey | OMVLYYYRSHJGRJ-UMQMGBFWSA-O |
| XLogP | 5.35 |
| TPSA | 129.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.77 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'four_member_lactones', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|