C32H30N2O10 — CID 158871908
(2,5-dioxopyrrolidin-1-yl) 6-acetamidohexanoate;2-(3-hydroxy-6-oxoxanthen-9-yl)benzoic acid (PubChem CID 158871908) has the molecular formula C32H30N2O10 and a molecular weight of 602.60 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 6-acetamidohexanoate;2-(3-hydroxy-6-oxoxanthen-9-yl)benzoic acid.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 6-acetamidohexanoate;2-(3-hydroxy-6-oxoxanthen-9-yl)benzoic acid |
|---|---|
| PubChem CID | 158871908 |
| Molecular Formula | C32H30N2O10 |
| Molecular Weight | 602.60 g/mol |
| Exact Mass | 602.19 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 6-acetamidohexanoate;2-(3-hydroxy-6-oxoxanthen-9-yl)benzoic acid |
| SMILES | CC(=O)NCCCCCC(=O)ON1C(=O)CCC1=O.O=C(O)c1ccccc1-c1c2ccc(=O)cc-2oc2cc(O)ccc12 |
| InChI | InChI=1S/C20H12O5.C12H18N2O5/c21-11-5-7-15-17(9-11)25-18-10-12(22)6-8-16(18)19(15)13-3-1-2-4-14(13)20(23)24;1-9(15)13-8-4-2-3-5-12(18)19-14-10(16)6-7-11(14)17/h1-10,21H,(H,23,24);2-8H2,1H3,(H,13,15) |
| InChIKey | JBYJGBIPGQLTKX-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 180.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.60 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|