C30H25NO9 — CID 101249851
2-[6-(2,5-dioxopyrrolidin-1-yl)oxy-6-oxohexyl]-6-(3-hydroxy-6-oxoxanthen-9-yl)benzoic acid (PubChem CID 101249851) has the molecular formula C30H25NO9 and a molecular weight of 543.53 g/mol. Its IUPAC name is 2-[6-(2,5-dioxopyrrolidin-1-yl)oxy-6-oxohexyl]-6-(3-hydroxy-6-oxoxanthen-9-yl)benzoic acid.
| Compound Name | 2-[6-(2,5-dioxopyrrolidin-1-yl)oxy-6-oxohexyl]-6-(3-hydroxy-6-oxoxanthen-9-yl)benzoic acid |
|---|---|
| PubChem CID | 101249851 |
| Molecular Formula | C30H25NO9 |
| Molecular Weight | 543.53 g/mol |
| Exact Mass | 543.15 |
| IUPAC Name | 2-[6-(2,5-dioxopyrrolidin-1-yl)oxy-6-oxohexyl]-6-(3-hydroxy-6-oxoxanthen-9-yl)benzoic acid |
| SMILES | O=C(CCCCCc1cccc(-c2c3ccc(=O)cc-3oc3cc(O)ccc23)c1C(=O)O)ON1C(=O)CCC1=O |
| InChI | InChI=1S/C30H25NO9/c32-18-9-11-20-23(15-18)39-24-16-19(33)10-12-21(24)29(20)22-7-4-6-17(28(22)30(37)38)5-2-1-3-8-27(36)40-31-25(34)13-14-26(31)35/h4,6-7,9-12,15-16,32H,1-3,5,8,13-14H2,(H,37,38) |
| InChIKey | MQMNHXRXAZPQGU-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 151.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.53 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|