C18H22N2O6 — CID 86625974
tert-butyl N-[2-[[2-(7-hydroxy-2-oxochromen-4-yl)acetyl]amino]ethyl]carbamate (PubChem CID 86625974) has the molecular formula C18H22N2O6 and a molecular weight of 362.38 g/mol. Its IUPAC name is tert-butyl N-[2-[[2-(7-hydroxy-2-oxochromen-4-yl)acetyl]amino]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[[2-(7-hydroxy-2-oxochromen-4-yl)acetyl]amino]ethyl]carbamate |
|---|---|
| PubChem CID | 86625974 |
| Molecular Formula | C18H22N2O6 |
| Molecular Weight | 362.38 g/mol |
| Exact Mass | 362.15 |
| IUPAC Name | tert-butyl N-[2-[[2-(7-hydroxy-2-oxochromen-4-yl)acetyl]amino]ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCNC(=O)Cc1cc(=O)oc2cc(O)ccc12 |
| InChI | InChI=1S/C18H22N2O6/c1-18(2,3)26-17(24)20-7-6-19-15(22)8-11-9-16(23)25-14-10-12(21)4-5-13(11)14/h4-5,9-10,21H,6-8H2,1-3H3,(H,19,22)(H,20,24) |
| InChIKey | PAEBPICFAMBUOB-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 117.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.38 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|