C15H14O6 — CID 158000063
methyl 5-(7-hydroxy-2-oxochromen-4-yl)-4-oxopentanoate (PubChem CID 158000063) has the molecular formula C15H14O6 and a molecular weight of 290.27 g/mol. Its IUPAC name is methyl 5-(7-hydroxy-2-oxochromen-4-yl)-4-oxopentanoate.
| Compound Name | methyl 5-(7-hydroxy-2-oxochromen-4-yl)-4-oxopentanoate |
|---|---|
| PubChem CID | 158000063 |
| Molecular Formula | C15H14O6 |
| Molecular Weight | 290.27 g/mol |
| Exact Mass | 290.08 |
| IUPAC Name | methyl 5-(7-hydroxy-2-oxochromen-4-yl)-4-oxopentanoate |
| SMILES | COC(=O)CCC(=O)Cc1cc(=O)oc2cc(O)ccc12 |
| InChI | InChI=1S/C15H14O6/c1-20-14(18)5-3-10(16)6-9-7-15(19)21-13-8-11(17)2-4-12(9)13/h2,4,7-8,17H,3,5-6H2,1H3 |
| InChIKey | UECWMNZGARWMSF-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 93.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.27 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|