C17H22N2O5 — CID 87635198
2-(7-hydroxy-2-oxochromen-4-yl)-N-[2-[(2-methylpropan-2-yl)oxyamino]ethyl]acetamide (PubChem CID 87635198) has the molecular formula C17H22N2O5 and a molecular weight of 334.37 g/mol. Its IUPAC name is 2-(7-hydroxy-2-oxochromen-4-yl)-N-[2-[(2-methylpropan-2-yl)oxyamino]ethyl]acetamide.
| Compound Name | 2-(7-hydroxy-2-oxochromen-4-yl)-N-[2-[(2-methylpropan-2-yl)oxyamino]ethyl]acetamide |
|---|---|
| PubChem CID | 87635198 |
| Molecular Formula | C17H22N2O5 |
| Molecular Weight | 334.37 g/mol |
| Exact Mass | 334.15 |
| IUPAC Name | 2-(7-hydroxy-2-oxochromen-4-yl)-N-[2-[(2-methylpropan-2-yl)oxyamino]ethyl]acetamide |
| SMILES | CC(C)(C)ONCCNC(=O)Cc1cc(=O)oc2cc(O)ccc12 |
| InChI | InChI=1S/C17H22N2O5/c1-17(2,3)24-19-7-6-18-15(21)8-11-9-16(22)23-14-10-12(20)4-5-13(11)14/h4-5,9-10,19-20H,6-8H2,1-3H3,(H,18,21) |
| InChIKey | LPFANCVOWHDOFB-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 100.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.37 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|