C17H20N2O6 — CID 87148125
5-[[2-(7-hydroxy-2-oxochromen-4-yl)acetyl]amino]pentylcarbamic acid (PubChem CID 87148125) has the molecular formula C17H20N2O6 and a molecular weight of 348.36 g/mol. Its IUPAC name is 5-[[2-(7-hydroxy-2-oxochromen-4-yl)acetyl]amino]pentylcarbamic acid.
| Compound Name | 5-[[2-(7-hydroxy-2-oxochromen-4-yl)acetyl]amino]pentylcarbamic acid |
|---|---|
| PubChem CID | 87148125 |
| Molecular Formula | C17H20N2O6 |
| Molecular Weight | 348.36 g/mol |
| Exact Mass | 348.13 |
| IUPAC Name | 5-[[2-(7-hydroxy-2-oxochromen-4-yl)acetyl]amino]pentylcarbamic acid |
| SMILES | O=C(O)NCCCCCNC(=O)Cc1cc(=O)oc2cc(O)ccc12 |
| InChI | InChI=1S/C17H20N2O6/c20-12-4-5-13-11(9-16(22)25-14(13)10-12)8-15(21)18-6-2-1-3-7-19-17(23)24/h4-5,9-10,19-20H,1-3,6-8H2,(H,18,21)(H,23,24) |
| InChIKey | FGXMXHLOVRGADN-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 128.87 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.36 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|