C22H16N2O8 — CID 91289685
2-(7-hydroxy-2-oxochromen-4-yl)-N'-[2-(4-hydroxy-2-oxochromen-3-yl)-2-oxoethyl]acetohydrazide (PubChem CID 91289685) has the molecular formula C22H16N2O8 and a molecular weight of 436.38 g/mol. Its IUPAC name is 2-(7-hydroxy-2-oxochromen-4-yl)-N'-[2-(4-hydroxy-2-oxochromen-3-yl)-2-oxoethyl]acetohydrazide.
| Compound Name | 2-(7-hydroxy-2-oxochromen-4-yl)-N'-[2-(4-hydroxy-2-oxochromen-3-yl)-2-oxoethyl]acetohydrazide |
|---|---|
| PubChem CID | 91289685 |
| Molecular Formula | C22H16N2O8 |
| Molecular Weight | 436.38 g/mol |
| Exact Mass | 436.09 |
| IUPAC Name | 2-(7-hydroxy-2-oxochromen-4-yl)-N'-[2-(4-hydroxy-2-oxochromen-3-yl)-2-oxoethyl]acetohydrazide |
| SMILES | O=C(Cc1cc(=O)oc2cc(O)ccc12)NNCC(=O)c1c(O)c2ccccc2oc1=O |
| InChI | InChI=1S/C22H16N2O8/c25-12-5-6-13-11(8-19(28)31-17(13)9-12)7-18(27)24-23-10-15(26)20-21(29)14-3-1-2-4-16(14)32-22(20)30/h1-6,8-9,23,25,29H,7,10H2,(H,24,27) |
| InChIKey | QIEFBJCRQHFAFE-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 159.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.38 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|