C22H25NO3 — CID 8992297
4-[[[(1R)-1-(4-ethylphenyl)-2-methylpropyl]amino]methyl]-7-hydroxychromen-2-one (PubChem CID 8992297) has the molecular formula C22H25NO3 and a molecular weight of 351.45 g/mol. Its IUPAC name is 4-[[[(1R)-1-(4-ethylphenyl)-2-methylpropyl]amino]methyl]-7-hydroxychromen-2-one.
| Compound Name | 4-[[[(1R)-1-(4-ethylphenyl)-2-methylpropyl]amino]methyl]-7-hydroxychromen-2-one |
|---|---|
| PubChem CID | 8992297 |
| Molecular Formula | C22H25NO3 |
| Molecular Weight | 351.45 g/mol |
| Exact Mass | 351.18 |
| IUPAC Name | 4-[[[(1R)-1-(4-ethylphenyl)-2-methylpropyl]amino]methyl]-7-hydroxychromen-2-one |
| SMILES | CCc1ccc([C@H](NCc2cc(=O)oc3cc(O)ccc23)C(C)C)cc1 |
| InChI | InChI=1S/C22H25NO3/c1-4-15-5-7-16(8-6-15)22(14(2)3)23-13-17-11-21(25)26-20-12-18(24)9-10-19(17)20/h5-12,14,22-24H,4,13H2,1-3H3/t22-/m1/s1 |
| InChIKey | NKGSHOOEMJOBLV-JOCHJYFZSA-N |
| XLogP | 4.55 |
| TPSA | 62.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.45 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|