C21H23NO2 — CID 9264105
7-ethyl-4-[[[(2R)-2-phenylpropyl]amino]methyl]chromen-2-one (PubChem CID 9264105) has the molecular formula C21H23NO2 and a molecular weight of 321.42 g/mol. Its IUPAC name is 7-ethyl-4-[[[(2R)-2-phenylpropyl]amino]methyl]chromen-2-one.
| Compound Name | 7-ethyl-4-[[[(2R)-2-phenylpropyl]amino]methyl]chromen-2-one |
|---|---|
| PubChem CID | 9264105 |
| Molecular Formula | C21H23NO2 |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.17 |
| IUPAC Name | 7-ethyl-4-[[[(2R)-2-phenylpropyl]amino]methyl]chromen-2-one |
| SMILES | CCc1ccc2c(CNC[C@H](C)c3ccccc3)cc(=O)oc2c1 |
| InChI | InChI=1S/C21H23NO2/c1-3-16-9-10-19-18(12-21(23)24-20(19)11-16)14-22-13-15(2)17-7-5-4-6-8-17/h4-12,15,22H,3,13-14H2,1-2H3/t15-/m0/s1 |
| InChIKey | IGSWCZQHJDODOB-HNNXBMFYSA-N |
| XLogP | 4.25 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|