C24H23NO2S — CID 9052092
7-ethyl-4-[[[(R)-(4-methylphenyl)-thiophen-2-ylmethyl]amino]methyl]chromen-2-one (PubChem CID 9052092) has the molecular formula C24H23NO2S and a molecular weight of 389.52 g/mol. Its IUPAC name is 7-ethyl-4-[[[(R)-(4-methylphenyl)-thiophen-2-ylmethyl]amino]methyl]chromen-2-one.
| Compound Name | 7-ethyl-4-[[[(R)-(4-methylphenyl)-thiophen-2-ylmethyl]amino]methyl]chromen-2-one |
|---|---|
| PubChem CID | 9052092 |
| Molecular Formula | C24H23NO2S |
| Molecular Weight | 389.52 g/mol |
| Exact Mass | 389.14 |
| IUPAC Name | 7-ethyl-4-[[[(R)-(4-methylphenyl)-thiophen-2-ylmethyl]amino]methyl]chromen-2-one |
| SMILES | CCc1ccc2c(CN[C@H](c3ccc(C)cc3)c3cccs3)cc(=O)oc2c1 |
| InChI | InChI=1S/C24H23NO2S/c1-3-17-8-11-20-19(14-23(26)27-21(20)13-17)15-25-24(22-5-4-12-28-22)18-9-6-16(2)7-10-18/h4-14,24-25H,3,15H2,1-2H3/t24-/m1/s1 |
| InChIKey | YCLUZUMJFLEOIT-XMMPIXPASA-N |
| XLogP | 5.60 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.52 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|