C20H23NO2S — CID 71887630
4-[[(2,2-dimethyl-1-thiophen-2-ylpropyl)amino]methyl]-7-methylchromen-2-one (PubChem CID 71887630) has the molecular formula C20H23NO2S and a molecular weight of 341.48 g/mol. Its IUPAC name is 4-[[(2,2-dimethyl-1-thiophen-2-ylpropyl)amino]methyl]-7-methylchromen-2-one.
| Compound Name | 4-[[(2,2-dimethyl-1-thiophen-2-ylpropyl)amino]methyl]-7-methylchromen-2-one |
|---|---|
| PubChem CID | 71887630 |
| Molecular Formula | C20H23NO2S |
| Molecular Weight | 341.48 g/mol |
| Exact Mass | 341.14 |
| IUPAC Name | 4-[[(2,2-dimethyl-1-thiophen-2-ylpropyl)amino]methyl]-7-methylchromen-2-one |
| SMILES | Cc1ccc2c(CNC(c3cccs3)C(C)(C)C)cc(=O)oc2c1 |
| InChI | InChI=1S/C20H23NO2S/c1-13-7-8-15-14(11-18(22)23-16(15)10-13)12-21-19(20(2,3)4)17-6-5-9-24-17/h5-11,19,21H,12H2,1-4H3 |
| InChIKey | MLZZNZCFNALKEC-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.48 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|