C25H23NO4 — CID 52513265
ethyl (2S)-2-[(7-methyl-2-oxochromen-4-yl)methylamino]-2-naphthalen-1-ylacetate (PubChem CID 52513265) has the molecular formula C25H23NO4 and a molecular weight of 401.46 g/mol. Its IUPAC name is ethyl (2S)-2-[(7-methyl-2-oxochromen-4-yl)methylamino]-2-naphthalen-1-ylacetate.
| Compound Name | ethyl (2S)-2-[(7-methyl-2-oxochromen-4-yl)methylamino]-2-naphthalen-1-ylacetate |
|---|---|
| PubChem CID | 52513265 |
| Molecular Formula | C25H23NO4 |
| Molecular Weight | 401.46 g/mol |
| Exact Mass | 401.16 |
| IUPAC Name | ethyl (2S)-2-[(7-methyl-2-oxochromen-4-yl)methylamino]-2-naphthalen-1-ylacetate |
| SMILES | CCOC(=O)[C@@H](NCc1cc(=O)oc2cc(C)ccc12)c1cccc2ccccc12 |
| InChI | InChI=1S/C25H23NO4/c1-3-29-25(28)24(21-10-6-8-17-7-4-5-9-19(17)21)26-15-18-14-23(27)30-22-13-16(2)11-12-20(18)22/h4-14,24,26H,3,15H2,1-2H3/t24-/m0/s1 |
| InChIKey | RGWXYZOWEBPVLT-DEOSSOPVSA-N |
| XLogP | 4.65 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.46 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|