C23H21NO2S — CID 9051367
6,7-dimethyl-4-[[[(S)-phenyl(thiophen-2-yl)methyl]amino]methyl]chromen-2-one (PubChem CID 9051367) has the molecular formula C23H21NO2S and a molecular weight of 375.49 g/mol. Its IUPAC name is 6,7-dimethyl-4-[[[(S)-phenyl(thiophen-2-yl)methyl]amino]methyl]chromen-2-one.
| Compound Name | 6,7-dimethyl-4-[[[(S)-phenyl(thiophen-2-yl)methyl]amino]methyl]chromen-2-one |
|---|---|
| PubChem CID | 9051367 |
| Molecular Formula | C23H21NO2S |
| Molecular Weight | 375.49 g/mol |
| Exact Mass | 375.13 |
| IUPAC Name | 6,7-dimethyl-4-[[[(S)-phenyl(thiophen-2-yl)methyl]amino]methyl]chromen-2-one |
| SMILES | Cc1cc2oc(=O)cc(CN[C@@H](c3ccccc3)c3cccs3)c2cc1C |
| InChI | InChI=1S/C23H21NO2S/c1-15-11-19-18(13-22(25)26-20(19)12-16(15)2)14-24-23(21-9-6-10-27-21)17-7-4-3-5-8-17/h3-13,23-24H,14H2,1-2H3/t23-/m0/s1 |
| InChIKey | INIBNRPJSGBWKO-QHCPKHFHSA-N |
| XLogP | 5.35 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.49 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|