C24H24NO2S+ — CID 9052419
(6,7-dimethyl-2-oxochromen-4-yl)methyl-[(S)-(4-methylphenyl)-thiophen-2-ylmethyl]azanium (PubChem CID 9052419) has the molecular formula C24H24NO2S+ and a molecular weight of 390.53 g/mol. Its IUPAC name is (6,7-dimethyl-2-oxochromen-4-yl)methyl-[(S)-(4-methylphenyl)-thiophen-2-ylmethyl]azanium.
| Compound Name | (6,7-dimethyl-2-oxochromen-4-yl)methyl-[(S)-(4-methylphenyl)-thiophen-2-ylmethyl]azanium |
|---|---|
| PubChem CID | 9052419 |
| Molecular Formula | C24H24NO2S+ |
| Molecular Weight | 390.53 g/mol |
| Exact Mass | 390.15 |
| IUPAC Name | (6,7-dimethyl-2-oxochromen-4-yl)methyl-[(S)-(4-methylphenyl)-thiophen-2-ylmethyl]azanium |
| SMILES | Cc1ccc([C@H]([NH2+]Cc2cc(=O)oc3cc(C)c(C)cc23)c2cccs2)cc1 |
| InChI | InChI=1S/C24H23NO2S/c1-15-6-8-18(9-7-15)24(22-5-4-10-28-22)25-14-19-13-23(26)27-21-12-17(3)16(2)11-20(19)21/h4-13,24-25H,14H2,1-3H3/p+1/t24-/m0/s1 |
| InChIKey | CYKDRVYYKGAPGX-DEOSSOPVSA-O |
| XLogP | 4.63 |
| TPSA | 46.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.53 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|