C22H20NO3S+ — CID 9051499
(7-hydroxy-8-methyl-2-oxochromen-4-yl)methyl-[(S)-phenyl(thiophen-2-yl)methyl]azanium (PubChem CID 9051499) has the molecular formula C22H20NO3S+ and a molecular weight of 378.47 g/mol. Its IUPAC name is (7-hydroxy-8-methyl-2-oxochromen-4-yl)methyl-[(S)-phenyl(thiophen-2-yl)methyl]azanium.
| Compound Name | (7-hydroxy-8-methyl-2-oxochromen-4-yl)methyl-[(S)-phenyl(thiophen-2-yl)methyl]azanium |
|---|---|
| PubChem CID | 9051499 |
| Molecular Formula | C22H20NO3S+ |
| Molecular Weight | 378.47 g/mol |
| Exact Mass | 378.12 |
| IUPAC Name | (7-hydroxy-8-methyl-2-oxochromen-4-yl)methyl-[(S)-phenyl(thiophen-2-yl)methyl]azanium |
| SMILES | Cc1c(O)ccc2c(C[NH2+][C@@H](c3ccccc3)c3cccs3)cc(=O)oc12 |
| InChI | InChI=1S/C22H19NO3S/c1-14-18(24)10-9-17-16(12-20(25)26-22(14)17)13-23-21(19-8-5-11-27-19)15-6-3-2-4-7-15/h2-12,21,23-24H,13H2,1H3/p+1/t21-/m0/s1 |
| InChIKey | AFXPEZTWTIMLIL-NRFANRHFSA-O |
| XLogP | 3.72 |
| TPSA | 67.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.47 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|