C20H22NO3+ — CID 9264124
(7-hydroxy-8-methyl-2-oxochromen-4-yl)methyl-[(2R)-2-phenylpropyl]azanium (PubChem CID 9264124) has the molecular formula C20H22NO3+ and a molecular weight of 324.40 g/mol. Its IUPAC name is (7-hydroxy-8-methyl-2-oxochromen-4-yl)methyl-[(2R)-2-phenylpropyl]azanium.
| Compound Name | (7-hydroxy-8-methyl-2-oxochromen-4-yl)methyl-[(2R)-2-phenylpropyl]azanium |
|---|---|
| PubChem CID | 9264124 |
| Molecular Formula | C20H22NO3+ |
| Molecular Weight | 324.40 g/mol |
| Exact Mass | 324.16 |
| IUPAC Name | (7-hydroxy-8-methyl-2-oxochromen-4-yl)methyl-[(2R)-2-phenylpropyl]azanium |
| SMILES | Cc1c(O)ccc2c(C[NH2+]C[C@H](C)c3ccccc3)cc(=O)oc12 |
| InChI | InChI=1S/C20H21NO3/c1-13(15-6-4-3-5-7-15)11-21-12-16-10-19(23)24-20-14(2)18(22)9-8-17(16)20/h3-10,13,21-22H,11-12H2,1-2H3/p+1/t13-/m0/s1 |
| InChIKey | AYOZGRVPFAGVLD-ZDUSSCGKSA-O |
| XLogP | 2.67 |
| TPSA | 67.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.40 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|