C22H28N2O2+2 — CID 9256720
[(1S)-2-[(7,8-dimethyl-2-oxochromen-4-yl)methylazaniumyl]-1-phenylethyl]-dimethylazanium (PubChem CID 9256720) has the molecular formula C22H28N2O2+2 and a molecular weight of 352.48 g/mol. Its IUPAC name is [(1S)-2-[(7,8-dimethyl-2-oxochromen-4-yl)methylazaniumyl]-1-phenylethyl]-dimethylazanium.
| Compound Name | [(1S)-2-[(7,8-dimethyl-2-oxochromen-4-yl)methylazaniumyl]-1-phenylethyl]-dimethylazanium |
|---|---|
| PubChem CID | 9256720 |
| Molecular Formula | C22H28N2O2+2 |
| Molecular Weight | 352.48 g/mol |
| Exact Mass | 352.21 |
| IUPAC Name | [(1S)-2-[(7,8-dimethyl-2-oxochromen-4-yl)methylazaniumyl]-1-phenylethyl]-dimethylazanium |
| SMILES | Cc1ccc2c(C[NH2+]C[C@H](c3ccccc3)[NH+](C)C)cc(=O)oc2c1C |
| InChI | InChI=1S/C22H26N2O2/c1-15-10-11-19-18(12-21(25)26-22(19)16(15)2)13-23-14-20(24(3)4)17-8-6-5-7-9-17/h5-12,20,23H,13-14H2,1-4H3/p+2/t20-/m1/s1 |
| InChIKey | YSRGRXZCPRIVCC-HXUWFJFHSA-P |
| XLogP | 1.36 |
| TPSA | 51.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.48 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|