C22H25NO2 — CID 9436998
7,8-dimethyl-4-[[[(1S)-1-phenylbutyl]amino]methyl]chromen-2-one (PubChem CID 9436998) has the molecular formula C22H25NO2 and a molecular weight of 335.45 g/mol. Its IUPAC name is 7,8-dimethyl-4-[[[(1S)-1-phenylbutyl]amino]methyl]chromen-2-one.
| Compound Name | 7,8-dimethyl-4-[[[(1S)-1-phenylbutyl]amino]methyl]chromen-2-one |
|---|---|
| PubChem CID | 9436998 |
| Molecular Formula | C22H25NO2 |
| Molecular Weight | 335.45 g/mol |
| Exact Mass | 335.19 |
| IUPAC Name | 7,8-dimethyl-4-[[[(1S)-1-phenylbutyl]amino]methyl]chromen-2-one |
| SMILES | CCC[C@H](NCc1cc(=O)oc2c(C)c(C)ccc12)c1ccccc1 |
| InChI | InChI=1S/C22H25NO2/c1-4-8-20(17-9-6-5-7-10-17)23-14-18-13-21(24)25-22-16(3)15(2)11-12-19(18)22/h5-7,9-13,20,23H,4,8,14H2,1-3H3/t20-/m0/s1 |
| InChIKey | RXXVTWYLYYAAHN-FQEVSTJZSA-N |
| XLogP | 5.04 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.45 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|