C19H18BrNO2 — CID 7928687
4-[(4-bromo-3-methylanilino)methyl]-7,8-dimethylchromen-2-one (PubChem CID 7928687) has the molecular formula C19H18BrNO2 and a molecular weight of 372.26 g/mol. Its IUPAC name is 4-[(4-bromo-3-methylanilino)methyl]-7,8-dimethylchromen-2-one.
| Compound Name | 4-[(4-bromo-3-methylanilino)methyl]-7,8-dimethylchromen-2-one |
|---|---|
| PubChem CID | 7928687 |
| Molecular Formula | C19H18BrNO2 |
| Molecular Weight | 372.26 g/mol |
| Exact Mass | 371.05 |
| IUPAC Name | 4-[(4-bromo-3-methylanilino)methyl]-7,8-dimethylchromen-2-one |
| SMILES | Cc1cc(NCc2cc(=O)oc3c(C)c(C)ccc23)ccc1Br |
| InChI | InChI=1S/C19H18BrNO2/c1-11-4-6-16-14(9-18(22)23-19(16)13(11)3)10-21-15-5-7-17(20)12(2)8-15/h4-9,21H,10H2,1-3H3 |
| InChIKey | RETGUUDDRRAQLM-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.26 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|