C21H22N2O3 — CID 34068677
N-[3-[(7,8-dimethyl-2-oxochromen-4-yl)methylamino]-2-methylphenyl]acetamide (PubChem CID 34068677) has the molecular formula C21H22N2O3 and a molecular weight of 350.42 g/mol. Its IUPAC name is N-[3-[(7,8-dimethyl-2-oxochromen-4-yl)methylamino]-2-methylphenyl]acetamide.
| Compound Name | N-[3-[(7,8-dimethyl-2-oxochromen-4-yl)methylamino]-2-methylphenyl]acetamide |
|---|---|
| PubChem CID | 34068677 |
| Molecular Formula | C21H22N2O3 |
| Molecular Weight | 350.42 g/mol |
| Exact Mass | 350.16 |
| IUPAC Name | N-[3-[(7,8-dimethyl-2-oxochromen-4-yl)methylamino]-2-methylphenyl]acetamide |
| SMILES | CC(=O)Nc1cccc(NCc2cc(=O)oc3c(C)c(C)ccc23)c1C |
| InChI | InChI=1S/C21H22N2O3/c1-12-8-9-17-16(10-20(25)26-21(17)13(12)2)11-22-18-6-5-7-19(14(18)3)23-15(4)24/h5-10,22H,11H2,1-4H3,(H,23,24) |
| InChIKey | PAJJGZAYFSMCBX-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 71.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.42 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|