C20H19NO3 — CID 9345895
4-[(4-acetylanilino)methyl]-7,8-dimethylchromen-2-one (PubChem CID 9345895) has the molecular formula C20H19NO3 and a molecular weight of 321.38 g/mol. Its IUPAC name is 4-[(4-acetylanilino)methyl]-7,8-dimethylchromen-2-one.
| Compound Name | 4-[(4-acetylanilino)methyl]-7,8-dimethylchromen-2-one |
|---|---|
| PubChem CID | 9345895 |
| Molecular Formula | C20H19NO3 |
| Molecular Weight | 321.38 g/mol |
| Exact Mass | 321.14 |
| IUPAC Name | 4-[(4-acetylanilino)methyl]-7,8-dimethylchromen-2-one |
| SMILES | CC(=O)c1ccc(NCc2cc(=O)oc3c(C)c(C)ccc23)cc1 |
| InChI | InChI=1S/C20H19NO3/c1-12-4-9-18-16(10-19(23)24-20(18)13(12)2)11-21-17-7-5-15(6-8-17)14(3)22/h4-10,21H,11H2,1-3H3 |
| InChIKey | DBSULWOKESJBKK-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 59.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.38 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|