C17H19NO4 — CID 110275082
N-[(7,8-dimethyl-2-oxochromen-4-yl)methyl]oxolane-2-carboxamide (PubChem CID 110275082) has the molecular formula C17H19NO4 and a molecular weight of 301.34 g/mol. Its IUPAC name is N-[(7,8-dimethyl-2-oxochromen-4-yl)methyl]oxolane-2-carboxamide.
| Compound Name | N-[(7,8-dimethyl-2-oxochromen-4-yl)methyl]oxolane-2-carboxamide |
|---|---|
| PubChem CID | 110275082 |
| Molecular Formula | C17H19NO4 |
| Molecular Weight | 301.34 g/mol |
| Exact Mass | 301.13 |
| IUPAC Name | N-[(7,8-dimethyl-2-oxochromen-4-yl)methyl]oxolane-2-carboxamide |
| SMILES | Cc1ccc2c(CNC(=O)C3CCCO3)cc(=O)oc2c1C |
| InChI | InChI=1S/C17H19NO4/c1-10-5-6-13-12(8-15(19)22-16(13)11(10)2)9-18-17(20)14-4-3-7-21-14/h5-6,8,14H,3-4,7,9H2,1-2H3,(H,18,20) |
| InChIKey | DZWKQBASLNNJOR-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.34 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|