C15H19NO3 — CID 82121626
N-[2-(3,4-dimethylphenyl)-2-oxoethyl]oxolane-2-carboxamide (PubChem CID 82121626) has the molecular formula C15H19NO3 and a molecular weight of 261.32 g/mol. Its IUPAC name is N-[2-(3,4-dimethylphenyl)-2-oxoethyl]oxolane-2-carboxamide.
| Compound Name | N-[2-(3,4-dimethylphenyl)-2-oxoethyl]oxolane-2-carboxamide |
|---|---|
| PubChem CID | 82121626 |
| Molecular Formula | C15H19NO3 |
| Molecular Weight | 261.32 g/mol |
| Exact Mass | 261.14 |
| IUPAC Name | N-[2-(3,4-dimethylphenyl)-2-oxoethyl]oxolane-2-carboxamide |
| SMILES | Cc1ccc(C(=O)CNC(=O)C2CCCO2)cc1C |
| InChI | InChI=1S/C15H19NO3/c1-10-5-6-12(8-11(10)2)13(17)9-16-15(18)14-4-3-7-19-14/h5-6,8,14H,3-4,7,9H2,1-2H3,(H,16,18) |
| InChIKey | KUNNZQWOVVOMJO-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.32 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |