C15H18FNO2 — CID 82122155
N-[2-(4-fluoro-3-methylphenyl)-2-oxoethyl]cyclopentanecarboxamide (PubChem CID 82122155) has the molecular formula C15H18FNO2 and a molecular weight of 263.31 g/mol. Its IUPAC name is N-[2-(4-fluoro-3-methylphenyl)-2-oxoethyl]cyclopentanecarboxamide.
| Compound Name | N-[2-(4-fluoro-3-methylphenyl)-2-oxoethyl]cyclopentanecarboxamide |
|---|---|
| PubChem CID | 82122155 |
| Molecular Formula | C15H18FNO2 |
| Molecular Weight | 263.31 g/mol |
| Exact Mass | 263.13 |
| IUPAC Name | N-[2-(4-fluoro-3-methylphenyl)-2-oxoethyl]cyclopentanecarboxamide |
| SMILES | Cc1cc(C(=O)CNC(=O)C2CCCC2)ccc1F |
| InChI | InChI=1S/C15H18FNO2/c1-10-8-12(6-7-13(10)16)14(18)9-17-15(19)11-4-2-3-5-11/h6-8,11H,2-5,9H2,1H3,(H,17,19) |
| InChIKey | WVIMGVDWDCCAAK-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.31 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |