C12H12FNO2 — CID 82114443
N-[2-(4-fluorophenyl)-2-oxoethyl]cyclopropanecarboxamide (PubChem CID 82114443) has the molecular formula C12H12FNO2 and a molecular weight of 221.23 g/mol. Its IUPAC name is N-[2-(4-fluorophenyl)-2-oxoethyl]cyclopropanecarboxamide.
| Compound Name | N-[2-(4-fluorophenyl)-2-oxoethyl]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 82114443 |
| Molecular Formula | C12H12FNO2 |
| Molecular Weight | 221.23 g/mol |
| Exact Mass | 221.09 |
| IUPAC Name | N-[2-(4-fluorophenyl)-2-oxoethyl]cyclopropanecarboxamide |
| SMILES | O=C(CNC(=O)C1CC1)c1ccc(F)cc1 |
| InChI | InChI=1S/C12H12FNO2/c13-10-5-3-8(4-6-10)11(15)7-14-12(16)9-1-2-9/h3-6,9H,1-2,7H2,(H,14,16) |
| InChIKey | LNJLBDHYWGZKNC-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.23 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |