C16H21NO3 — CID 9264789
4-[[[(2S)-1-hydroxybutan-2-yl]amino]methyl]-7,8-dimethylchromen-2-one (PubChem CID 9264789) has the molecular formula C16H21NO3 and a molecular weight of 275.35 g/mol. Its IUPAC name is 4-[[[(2S)-1-hydroxybutan-2-yl]amino]methyl]-7,8-dimethylchromen-2-one.
| Compound Name | 4-[[[(2S)-1-hydroxybutan-2-yl]amino]methyl]-7,8-dimethylchromen-2-one |
|---|---|
| PubChem CID | 9264789 |
| Molecular Formula | C16H21NO3 |
| Molecular Weight | 275.35 g/mol |
| Exact Mass | 275.15 |
| IUPAC Name | 4-[[[(2S)-1-hydroxybutan-2-yl]amino]methyl]-7,8-dimethylchromen-2-one |
| SMILES | CC[C@@H](CO)NCc1cc(=O)oc2c(C)c(C)ccc12 |
| InChI | InChI=1S/C16H21NO3/c1-4-13(9-18)17-8-12-7-15(19)20-16-11(3)10(2)5-6-14(12)16/h5-7,13,17-18H,4,8-9H2,1-3H3/t13-/m0/s1 |
| InChIKey | IUKSPYQUHCOPBB-ZDUSSCGKSA-N |
| XLogP | 2.27 |
| TPSA | 62.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.35 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|