C23H27NO3 — CID 8992564
4-[[[(1R)-1-(4-ethylphenyl)-2-methylpropyl]amino]methyl]-7-hydroxy-8-methylchromen-2-one (PubChem CID 8992564) has the molecular formula C23H27NO3 and a molecular weight of 365.47 g/mol. Its IUPAC name is 4-[[[(1R)-1-(4-ethylphenyl)-2-methylpropyl]amino]methyl]-7-hydroxy-8-methylchromen-2-one.
| Compound Name | 4-[[[(1R)-1-(4-ethylphenyl)-2-methylpropyl]amino]methyl]-7-hydroxy-8-methylchromen-2-one |
|---|---|
| PubChem CID | 8992564 |
| Molecular Formula | C23H27NO3 |
| Molecular Weight | 365.47 g/mol |
| Exact Mass | 365.20 |
| IUPAC Name | 4-[[[(1R)-1-(4-ethylphenyl)-2-methylpropyl]amino]methyl]-7-hydroxy-8-methylchromen-2-one |
| SMILES | CCc1ccc([C@H](NCc2cc(=O)oc3c(C)c(O)ccc23)C(C)C)cc1 |
| InChI | InChI=1S/C23H27NO3/c1-5-16-6-8-17(9-7-16)22(14(2)3)24-13-18-12-21(26)27-23-15(4)20(25)11-10-19(18)23/h6-12,14,22,24-25H,5,13H2,1-4H3/t22-/m1/s1 |
| InChIKey | KOWAPCUKTBDURA-JOCHJYFZSA-N |
| XLogP | 4.86 |
| TPSA | 62.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.47 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|