C19H19NO3 — CID 9345429
4-[(2,4-dimethylanilino)methyl]-7-hydroxy-8-methylchromen-2-one (PubChem CID 9345429) has the molecular formula C19H19NO3 and a molecular weight of 309.37 g/mol. Its IUPAC name is 4-[(2,4-dimethylanilino)methyl]-7-hydroxy-8-methylchromen-2-one.
| Compound Name | 4-[(2,4-dimethylanilino)methyl]-7-hydroxy-8-methylchromen-2-one |
|---|---|
| PubChem CID | 9345429 |
| Molecular Formula | C19H19NO3 |
| Molecular Weight | 309.37 g/mol |
| Exact Mass | 309.14 |
| IUPAC Name | 4-[(2,4-dimethylanilino)methyl]-7-hydroxy-8-methylchromen-2-one |
| SMILES | Cc1ccc(NCc2cc(=O)oc3c(C)c(O)ccc23)c(C)c1 |
| InChI | InChI=1S/C19H19NO3/c1-11-4-6-16(12(2)8-11)20-10-14-9-18(22)23-19-13(3)17(21)7-5-15(14)19/h4-9,20-21H,10H2,1-3H3 |
| InChIKey | VVZMNOOJFSHZBR-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 62.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.37 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|