C22H26ClNO3 — CID 44667600
4-butyl-8-[(2,5-dimethylanilino)methyl]-7-hydroxychromen-2-one;hydrochloride (PubChem CID 44667600) has the molecular formula C22H26ClNO3 and a molecular weight of 387.91 g/mol. Its IUPAC name is 4-butyl-8-[(2,5-dimethylanilino)methyl]-7-hydroxychromen-2-one;hydrochloride.
| Compound Name | 4-butyl-8-[(2,5-dimethylanilino)methyl]-7-hydroxychromen-2-one;hydrochloride |
|---|---|
| PubChem CID | 44667600 |
| Molecular Formula | C22H26ClNO3 |
| Molecular Weight | 387.91 g/mol |
| Exact Mass | 387.16 |
| IUPAC Name | 4-butyl-8-[(2,5-dimethylanilino)methyl]-7-hydroxychromen-2-one;hydrochloride |
| SMILES | CCCCc1cc(=O)oc2c(CNc3cc(C)ccc3C)c(O)ccc12.Cl |
| InChI | InChI=1S/C22H25NO3.ClH/c1-4-5-6-16-12-21(25)26-22-17(16)9-10-20(24)18(22)13-23-19-11-14(2)7-8-15(19)3;/h7-12,23-24H,4-6,13H2,1-3H3;1H |
| InChIKey | PIYWYMAKNYJJNS-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 62.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.91 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|