C26H26ClNO4 — CID 45370577
4-butyl-7-hydroxy-8-[(4-phenoxyanilino)methyl]chromen-2-one;hydrochloride (PubChem CID 45370577) has the molecular formula C26H26ClNO4 and a molecular weight of 451.95 g/mol. Its IUPAC name is 4-butyl-7-hydroxy-8-[(4-phenoxyanilino)methyl]chromen-2-one;hydrochloride.
| Compound Name | 4-butyl-7-hydroxy-8-[(4-phenoxyanilino)methyl]chromen-2-one;hydrochloride |
|---|---|
| PubChem CID | 45370577 |
| Molecular Formula | C26H26ClNO4 |
| Molecular Weight | 451.95 g/mol |
| Exact Mass | 451.16 |
| IUPAC Name | 4-butyl-7-hydroxy-8-[(4-phenoxyanilino)methyl]chromen-2-one;hydrochloride |
| SMILES | CCCCc1cc(=O)oc2c(CNc3ccc(Oc4ccccc4)cc3)c(O)ccc12.Cl |
| InChI | InChI=1S/C26H25NO4.ClH/c1-2-3-7-18-16-25(29)31-26-22(18)14-15-24(28)23(26)17-27-19-10-12-21(13-11-19)30-20-8-5-4-6-9-20;/h4-6,8-16,27-28H,2-3,7,17H2,1H3;1H |
| InChIKey | HRRUNDXTJFOMLC-UHFFFAOYSA-N |
| XLogP | 6.67 |
| TPSA | 71.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.95 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|