C19H25NO5 — CID 5417021
(2R)-2-[(7-hydroxy-2-oxo-4-propylchromen-8-yl)methylamino]-4-methylpentanoic acid (PubChem CID 5417021) has the molecular formula C19H25NO5 and a molecular weight of 347.41 g/mol. Its IUPAC name is (2R)-2-[(7-hydroxy-2-oxo-4-propylchromen-8-yl)methylamino]-4-methylpentanoic acid.
| Compound Name | (2R)-2-[(7-hydroxy-2-oxo-4-propylchromen-8-yl)methylamino]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 5417021 |
| Molecular Formula | C19H25NO5 |
| Molecular Weight | 347.41 g/mol |
| Exact Mass | 347.17 |
| IUPAC Name | (2R)-2-[(7-hydroxy-2-oxo-4-propylchromen-8-yl)methylamino]-4-methylpentanoic acid |
| SMILES | CCCc1cc(=O)oc2c(CN[C@H](CC(C)C)C(=O)O)c(O)ccc12 |
| InChI | InChI=1S/C19H25NO5/c1-4-5-12-9-17(22)25-18-13(12)6-7-16(21)14(18)10-20-15(19(23)24)8-11(2)3/h6-7,9,11,15,20-21H,4-5,8,10H2,1-3H3,(H,23,24)/t15-/m1/s1 |
| InChIKey | IQZDVXSHBFSQBL-OAHLLOKOSA-N |
| XLogP | 3.04 |
| TPSA | 99.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.41 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|