C19H25NO5 — CID 167496418
(2S)-2-[(7-hydroxy-4-methyl-2-oxochromen-8-yl)methylamino]-5,5-dimethylhexanoic acid (PubChem CID 167496418) has the molecular formula C19H25NO5 and a molecular weight of 347.41 g/mol. Its IUPAC name is (2S)-2-[(7-hydroxy-4-methyl-2-oxochromen-8-yl)methylamino]-5,5-dimethylhexanoic acid.
| Compound Name | (2S)-2-[(7-hydroxy-4-methyl-2-oxochromen-8-yl)methylamino]-5,5-dimethylhexanoic acid |
|---|---|
| PubChem CID | 167496418 |
| Molecular Formula | C19H25NO5 |
| Molecular Weight | 347.41 g/mol |
| Exact Mass | 347.17 |
| IUPAC Name | (2S)-2-[(7-hydroxy-4-methyl-2-oxochromen-8-yl)methylamino]-5,5-dimethylhexanoic acid |
| SMILES | Cc1cc(=O)oc2c(CN[C@@H](CCC(C)(C)C)C(=O)O)c(O)ccc12 |
| InChI | InChI=1S/C19H25NO5/c1-11-9-16(22)25-17-12(11)5-6-15(21)13(17)10-20-14(18(23)24)7-8-19(2,3)4/h5-6,9,14,20-21H,7-8,10H2,1-4H3,(H,23,24)/t14-/m0/s1 |
| InChIKey | MIMUGCYWKVEHFW-AWEZNQCLSA-N |
| XLogP | 3.18 |
| TPSA | 99.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.41 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|