C18H23NO5 — CID 5417027
(2S)-2-[(7-hydroxy-2-oxo-4-propylchromen-8-yl)methylamino]-3-methylbutanoic acid (PubChem CID 5417027) has the molecular formula C18H23NO5 and a molecular weight of 333.38 g/mol. Its IUPAC name is (2S)-2-[(7-hydroxy-2-oxo-4-propylchromen-8-yl)methylamino]-3-methylbutanoic acid.
| Compound Name | (2S)-2-[(7-hydroxy-2-oxo-4-propylchromen-8-yl)methylamino]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 5417027 |
| Molecular Formula | C18H23NO5 |
| Molecular Weight | 333.38 g/mol |
| Exact Mass | 333.16 |
| IUPAC Name | (2S)-2-[(7-hydroxy-2-oxo-4-propylchromen-8-yl)methylamino]-3-methylbutanoic acid |
| SMILES | CCCc1cc(=O)oc2c(CN[C@H](C(=O)O)C(C)C)c(O)ccc12 |
| InChI | InChI=1S/C18H23NO5/c1-4-5-11-8-15(21)24-17-12(11)6-7-14(20)13(17)9-19-16(10(2)3)18(22)23/h6-8,10,16,19-20H,4-5,9H2,1-3H3,(H,22,23)/t16-/m0/s1 |
| InChIKey | UPVQCGYGOPISTK-INIZCTEOSA-N |
| XLogP | 2.65 |
| TPSA | 99.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.38 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|