C23H25NO5 — CID 75748254
2-[(4-butyl-7-hydroxy-2-oxochromen-8-yl)methylamino]-3-phenylpropanoic acid (PubChem CID 75748254) has the molecular formula C23H25NO5 and a molecular weight of 395.46 g/mol. Its IUPAC name is 2-[(4-butyl-7-hydroxy-2-oxochromen-8-yl)methylamino]-3-phenylpropanoic acid.
| Compound Name | 2-[(4-butyl-7-hydroxy-2-oxochromen-8-yl)methylamino]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 75748254 |
| Molecular Formula | C23H25NO5 |
| Molecular Weight | 395.46 g/mol |
| Exact Mass | 395.17 |
| IUPAC Name | 2-[(4-butyl-7-hydroxy-2-oxochromen-8-yl)methylamino]-3-phenylpropanoic acid |
| SMILES | CCCCc1cc(=O)oc2c(CNC(Cc3ccccc3)C(=O)O)c(O)ccc12 |
| InChI | InChI=1S/C23H25NO5/c1-2-3-9-16-13-21(26)29-22-17(16)10-11-20(25)18(22)14-24-19(23(27)28)12-15-7-5-4-6-8-15/h4-8,10-11,13,19,24-25H,2-3,9,12,14H2,1H3,(H,27,28) |
| InChIKey | SFOHVNOYPYRRLD-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 99.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.46 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|