C12H8O6 — CID 175599461
2-(7-hydroxy-4-methyl-2-oxochromen-8-yl)-2-oxoacetic acid (PubChem CID 175599461) has the molecular formula C12H8O6 and a molecular weight of 248.19 g/mol. Its IUPAC name is 2-(7-hydroxy-4-methyl-2-oxochromen-8-yl)-2-oxoacetic acid.
| Compound Name | 2-(7-hydroxy-4-methyl-2-oxochromen-8-yl)-2-oxoacetic acid |
|---|---|
| PubChem CID | 175599461 |
| Molecular Formula | C12H8O6 |
| Molecular Weight | 248.19 g/mol |
| Exact Mass | 248.03 |
| IUPAC Name | 2-(7-hydroxy-4-methyl-2-oxochromen-8-yl)-2-oxoacetic acid |
| SMILES | Cc1cc(=O)oc2c(C(=O)C(=O)O)c(O)ccc12 |
| InChI | InChI=1S/C12H8O6/c1-5-4-8(14)18-11-6(5)2-3-7(13)9(11)10(15)12(16)17/h2-4,13H,1H3,(H,16,17) |
| InChIKey | MDTRMFNVUZXKJN-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.19 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|