C19H15NO5Zn — CID 135484814
2-[1-(7-hydroxy-4-methyl-2-oxochromen-8-yl)ethylideneamino]benzoic acid;zinc (PubChem CID 135484814) has the molecular formula C19H15NO5Zn and a molecular weight of 402.72 g/mol. Its IUPAC name is 2-[1-(7-hydroxy-4-methyl-2-oxochromen-8-yl)ethylideneamino]benzoic acid;zinc.
| Compound Name | 2-[1-(7-hydroxy-4-methyl-2-oxochromen-8-yl)ethylideneamino]benzoic acid;zinc |
|---|---|
| PubChem CID | 135484814 |
| Molecular Formula | C19H15NO5Zn |
| Molecular Weight | 402.72 g/mol |
| Exact Mass | 401.02 |
| IUPAC Name | 2-[1-(7-hydroxy-4-methyl-2-oxochromen-8-yl)ethylideneamino]benzoic acid;zinc |
| SMILES | C/C(=N\c1ccccc1C(=O)O)c1c(O)ccc2c(C)cc(=O)oc12.[Zn] |
| InChI | InChI=1S/C19H15NO5.Zn/c1-10-9-16(22)25-18-12(10)7-8-15(21)17(18)11(2)20-14-6-4-3-5-13(14)19(23)24;/h3-9,21H,1-2H3,(H,23,24);/b20-11+; |
| InChIKey | GHTTUUXAYYHTGM-DOELHFPHSA-N |
| XLogP | 3.64 |
| TPSA | 100.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.72 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|