C18H19CuNO4S+2 — CID 50897381
copper;[4-methyl-8-[C-methyl-N-(2-sulfaniumylphenyl)carbonimidoyl]-2-oxochromen-7-yl]oxidanium;hydrate (PubChem CID 50897381) has the molecular formula C18H19CuNO4S+2 and a molecular weight of 408.97 g/mol. Its IUPAC name is copper;[4-methyl-8-[C-methyl-N-(2-sulfaniumylphenyl)carbonimidoyl]-2-oxochromen-7-yl]oxidanium;hydrate.
| Compound Name | copper;[4-methyl-8-[C-methyl-N-(2-sulfaniumylphenyl)carbonimidoyl]-2-oxochromen-7-yl]oxidanium;hydrate |
|---|---|
| PubChem CID | 50897381 |
| Molecular Formula | C18H19CuNO4S+2 |
| Molecular Weight | 408.97 g/mol |
| Exact Mass | 408.03 |
| IUPAC Name | copper;[4-methyl-8-[C-methyl-N-(2-sulfaniumylphenyl)carbonimidoyl]-2-oxochromen-7-yl]oxidanium;hydrate |
| SMILES | C/C(=N\c1ccccc1[SH2+])c1c([OH2+])ccc2c(C)cc(=O)oc12.O.[Cu] |
| InChI | InChI=1S/C18H15NO3S.Cu.H2O/c1-10-9-16(21)22-18-12(10)7-8-14(20)17(18)11(2)19-13-5-3-4-6-15(13)23;;/h3-9,20,23H,1-2H3;;1H2/p+2/b19-11+;; |
| InChIKey | JUVUMWPSAKHUMW-KRYQRJNDSA-P |
| XLogP | 2.22 |
| TPSA | 96.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.97 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|