C18H18CuNO4S+3 — CID 50910554
copper;[4-methyl-8-[C-methyl-N-(2-sulfaniumylphenyl)carbonimidoyl]-2-oxochromen-7-yl]oxidanium;hydroxide (PubChem CID 50910554) has the molecular formula C18H18CuNO4S+3 and a molecular weight of 407.96 g/mol. Its IUPAC name is copper;[4-methyl-8-[C-methyl-N-(2-sulfaniumylphenyl)carbonimidoyl]-2-oxochromen-7-yl]oxidanium;hydroxide.
| Compound Name | copper;[4-methyl-8-[C-methyl-N-(2-sulfaniumylphenyl)carbonimidoyl]-2-oxochromen-7-yl]oxidanium;hydroxide |
|---|---|
| PubChem CID | 50910554 |
| Molecular Formula | C18H18CuNO4S+3 |
| Molecular Weight | 407.96 g/mol |
| Exact Mass | 407.02 |
| IUPAC Name | copper;[4-methyl-8-[C-methyl-N-(2-sulfaniumylphenyl)carbonimidoyl]-2-oxochromen-7-yl]oxidanium;hydroxide |
| SMILES | C/C(=N\c1ccccc1[SH2+])c1c([OH2+])ccc2c(C)cc(=O)oc12.[Cu+2].[OH-] |
| InChI | InChI=1S/C18H15NO3S.Cu.H2O/c1-10-9-16(21)22-18-12(10)7-8-14(20)17(18)11(2)19-13-5-3-4-6-15(13)23;;/h3-9,20,23H,1-2H3;;1H2/q;+2;/p+1/b19-11+;; |
| InChIKey | ALEDIDFCZJBZAX-KRYQRJNDSA-O |
| XLogP | 2.87 |
| TPSA | 95.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.96 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|