C32H20N2NiO6 — CID 86573801
4-methyl-8-[[8-[(4-methyl-7-oxido-2-oxochromen-8-yl)methylideneamino]naphthalen-1-yl]iminomethyl]-2-oxochromen-7-olate;nickel(2+) (PubChem CID 86573801) has the molecular formula C32H20N2NiO6 and a molecular weight of 587.21 g/mol. Its IUPAC name is 4-methyl-8-[[8-[(4-methyl-7-oxido-2-oxochromen-8-yl)methylideneamino]naphthalen-1-yl]iminomethyl]-2-oxochromen-7-olate;nickel(2+).
| Compound Name | 4-methyl-8-[[8-[(4-methyl-7-oxido-2-oxochromen-8-yl)methylideneamino]naphthalen-1-yl]iminomethyl]-2-oxochromen-7-olate;nickel(2+) |
|---|---|
| PubChem CID | 86573801 |
| Molecular Formula | C32H20N2NiO6 |
| Molecular Weight | 587.21 g/mol |
| Exact Mass | 586.07 |
| IUPAC Name | 4-methyl-8-[[8-[(4-methyl-7-oxido-2-oxochromen-8-yl)methylideneamino]naphthalen-1-yl]iminomethyl]-2-oxochromen-7-olate;nickel(2+) |
| SMILES | Cc1cc(=O)oc2c(/C=N\c3cccc4cccc(/N=C/c5c([O-])ccc6c(C)cc(=O)oc56)c34)c([O-])ccc12.[Ni+2] |
| InChI | InChI=1S/C32H22N2O6.Ni/c1-17-13-28(37)39-31-20(17)9-11-26(35)22(31)15-33-24-7-3-5-19-6-4-8-25(30(19)24)34-16-23-27(36)12-10-21-18(2)14-29(38)40-32(21)23;/h3-16,35-36H,1-2H3;/q;+2/p-2/b33-15-,34-16+; |
| InChIKey | VJLQRJHXCJYOPV-XMSXTQPYSA-L |
| XLogP | 5.32 |
| TPSA | 131.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.21 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|