C13H9NO3 — CID 134912214
2-ethenyl-6-methylpyrano[3,2-g][1,3]benzoxazol-8-one (PubChem CID 134912214) has the molecular formula C13H9NO3 and a molecular weight of 227.22 g/mol. Its IUPAC name is 2-ethenyl-6-methylpyrano[3,2-g][1,3]benzoxazol-8-one.
| Compound Name | 2-ethenyl-6-methylpyrano[3,2-g][1,3]benzoxazol-8-one |
|---|---|
| PubChem CID | 134912214 |
| Molecular Formula | C13H9NO3 |
| Molecular Weight | 227.22 g/mol |
| Exact Mass | 227.06 |
| IUPAC Name | 2-ethenyl-6-methylpyrano[3,2-g][1,3]benzoxazol-8-one |
| SMILES | C=Cc1nc2ccc3c(C)cc(=O)oc3c2o1 |
| InChI | InChI=1S/C13H9NO3/c1-3-10-14-9-5-4-8-7(2)6-11(15)17-12(8)13(9)16-10/h3-6H,1H2,2H3 |
| InChIKey | RMXIVTJPZBMBAA-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 56.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.22 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|